| Approval: | JMAFF |
|---|---|
| IUPAC PIN: | 2-(3,4-dichlorophenoxy)-N,N-diethylethan-1-amine |
| IUPAC name: | 2-(3,4-dichlorophenoxy)-N,N-diethylethanamine or 2-(3,4-dichlorophenoxy)triethylamine |
| CAS name: | 2-(3,4-dichlorophenoxy)-N,N-diethylethanamine |
| CAS Reg. No.: | 65202-07-5 |
| Formula: | C12H17Cl2NO |
| Activity: | plant growth regulators (growth stimulator) |
| Notes: | There is no ISO common name for this substance; the name “DCPTA” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries, and is also approved in China (增产胺). |
| Structure: |  |
| Pronunciation: | dē sē pē tē ā Guide to British pronunciation |
| InChIKey: | LOVYCUYJRWLTSU-UHFFFAOYSA-N |
| InChI: | InChI=1S/C12H17Cl2NO/c1-3-15(4-2)7-8-16-10-5-6-11(13)12(14)9-10/h5-6,9H,3-4,7-8H2,1-2H3 |