| Approval: | ISO |
|---|---|
| IUPAC PIN: | (S)-cyano(3-phenoxyphenyl)methyl (1R,3R)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
| IUPAC name: | (S)-α-cyano-3-phenoxybenzyl (1R,3R)-3-(2,2-dibromovinyl)-2,2-dimethylcyclopropanecarboxylate Rothamsted-style stereodescriptors: (S)-α-cyano-3-phenoxybenzyl (1R)-cis-3-(2,2-dibromovinyl)-2,2-dimethylcyclopropanecarboxylate |
| CAS name: | (S)-cyano(3-phenoxyphenyl)methyl (1R,3R)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropanecarboxylate |
| CAS Reg. No.: | 52918-63-5 |
| Formula: | C22H19Br2NO3 |
| Activity: | insecticides (pyrethroid) |
| Notes: | The name “decamethrin” was originally proposed for this compound and was used in the literature. |
| Structure: | |
| Pronunciation: | děl-ta-mēth-rǐn Guide to British pronunciation |
| InChIKey: | OWZREIFADZCYQD-NSHGMRRFSA-N |
| InChI: | InChI=1S/C22H19Br2NO3/c1-22(2)17(12-19(23)24)20(22)21(26)28-18(13-25)14-7-6-10-16(11-14)27-15-8-4-3-5-9-15/h3-12,17-18,20H,1-2H3/t17-,18+,20-/m0/s1 |
A data sheet from the Compendium of Pesticide Common Names