Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | 2-methylpropyl (2,4,5-trichlorophenoxy)acetate |
IUPAC name: | 2-methylpropyl (2,4,5-trichlorophenoxy)acetate 1979 Rules: isobutyl (2,4,5-trichlorophenoxy)acetate |
CAS name: | 2-methylpropyl 2-(2,4,5-trichlorophenoxy)acetate |
CAS Reg. No.: | 4938-72-1 |
Formula: | C12H13Cl3O3 |
Activity: | herbicides (phenoxyacetic) |
Notes: | This substance is a derivative of 2,4,5-T [93-76-5]. |
Structure: | |
Pronunciation: | too for fīv tē ī-sō-bū-tīl Guide to British pronunciation |
InChIKey: | KIIVFWSIMRWBKW-UHFFFAOYSA-N |
InChI: | InChI=1S/C12H13Cl3O3/c1-7(2)5-18-12(16)6-17-11-4-9(14)8(13)3-10(11)15/h3-4,7H,5-6H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names