Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | propan-2-yl (2,4,5-trichlorophenoxy)acetate |
IUPAC name: | isopropyl (2,4,5-trichlorophenoxy)acetate |
CAS name: | 1-methylethyl 2-(2,4,5-trichlorophenoxy)acetate |
CAS Reg. No.: | 93-78-7 |
Formula: | C11H11Cl3O3 |
Activity: | herbicides (phenoxyacetic) |
Notes: | This substance is a derivative of 2,4,5-T [93-76-5] |
Structure: | |
Pronunciation: | too for fīv tē ī-sō-prō-pīl Guide to British pronunciation |
InChIKey: | SXHQLHGHMREHMX-UHFFFAOYSA-N |
InChI: | InChI=1S/C11H11Cl3O3/c1-6(2)17-11(15)5-16-10-4-8(13)7(12)3-9(10)14/h3-4,6H,5H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names