Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | 2-butoxyethyl (2,4-dichlorophenoxy)acetate |
IUPAC name: | 2-butoxyethyl (2,4-dichlorophenoxy)acetate |
CAS name: | 2-butoxyethyl 2-(2,4-dichlorophenoxy)acetate |
CAS Reg. No.: | 1929-73-3 |
Formula: | C14H18Cl2O4 |
Activity: | herbicides (phenoxyacetic) |
Notes: | This substance is a derivative of 2,4-D [94-75-7]. |
Structure: | |
Pronunciation: | too for dē bū-tō-tīl Guide to British pronunciation |
InChIKey: | ZMWGIGHRZQTQRE-UHFFFAOYSA-N |
InChI: | InChI=1S/C14H18Cl2O4/c1-2-3-6-18-7-8-19-14(17)10-20-13-5-4-11(15)9-12(13)16/h4-5,9H,2-3,6-8,10H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names