| Approval: | Parent – ISO | 
|---|---|
| IUPAC PIN: | (2,4-dichlorophenoxy)acetic acid—N-ethylethanamine (1/1) | 
| IUPAC name: | (2,4-dichlorophenoxy)acetic acid - diethylamine (1:1) or diethylammonium (2,4-dichlorophenoxy)acetate  | 
| CAS name: | 2-(2,4-dichlorophenoxy)acetic acid compound with N-ethylethanamine (1:1) | 
| CAS Reg. No.: | 20940-37-8 | 
| Formula: | C12H17Cl2NO3 | 
| Activity: | herbicides (phenoxyacetic) | 
| Notes: | This substance is a derivative of 2,4-D [94-75-7]. | 
| Structure: | |
| Pronunciation: | too for dē dī-ē-thīl-a-mōn-ē-am Guide to British pronunciation | 
| InChIKey: | VQRSXYVRBBWVSQ-UHFFFAOYSA-N | 
| InChI: | InChI=1S/C8H6Cl2O3.C4H11N/c9-5-1-2-7(6(10)3-5)13-4-8(11)12;1-3-5-4-2/h1-3H,4H2,(H,11,12);5H,3-4H2,1-2H3 | 
A data sheet from the Compendium of Pesticide Common Names