| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | (2,4-dichlorophenoxy)acetic acid—2,2′-azanediyldi(ethan-1-ol) (1/1) |
| IUPAC name: | (2,4-dichlorophenoxy)acetic acid - 2,2′-iminodiethanol (1:1) or bis(2-hydroxyethyl)ammonium (2,4-dichlorophenoxy)acetate |
| CAS name: | 2-(2,4-dichlorophenoxy)acetic acid compound with 2,2′-iminobis[ethanol] (1:1) |
| CAS Reg. No.: | 5742-19-8 |
| Formula: | C12H17Cl2NO5 |
| Activity: | herbicides (phenoxyacetic) |
| Notes: | This substance is a derivative of 2,4-D [94-75-7]. |
| Structure: | |
| Pronunciation: | too for dē dī-ǒl-a-mēn Guide to British pronunciation |
| InChIKey: | FDMDZIBZKGXZPT-UHFFFAOYSA-N |
| InChI: | InChI=1S/C8H6Cl2O3.C4H11NO2/c9-5-1-2-7(6(10)3-5)13-4-8(11)12;6-3-1-5-2-4-7/h1-3H,4H2,(H,11,12);5-7H,1-4H2 |
A data sheet from the Compendium of Pesticide Common Names