Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | ethyl (2,4-dichlorophenoxy)acetate |
IUPAC name: | ethyl (2,4-dichlorophenoxy)acetate |
CAS name: | ethyl 2-(2,4-dichlorophenoxy)acetate |
CAS Reg. No.: | 533-23-3 |
Formula: | C10H10Cl2O3 |
Activity: | herbicides (phenoxyacetic) |
Notes: | This substance is a derivative of 2,4-D [94-75-7]. |
Structure: | |
Pronunciation: | too for dē ē-thīl Guide to British pronunciation |
InChIKey: | JSLBZIVMVVHMDJ-UHFFFAOYSA-N |
InChI: | InChI=1S/C10H10Cl2O3/c1-2-14-10(13)6-15-9-4-3-7(11)5-8(9)12/h3-5H,2,6H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names