| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | (2,4-dichlorophenoxy)acetic acid—methanamine (1/1) |
| IUPAC name: | (2,4-dichlorophenoxy)acetic acid - methylamine (1:1) or methylammonium (2,4-dichlorophenoxy)acetate |
| CAS name: | 2-(2,4-dichlorophenoxy)acetic acid compound with methanamine (1:1) |
| CAS Reg. No.: | 51173-63-8 |
| Formula: | C9H11Cl2NO3 |
| Activity: | herbicides (phenoxyacetic) |
| Notes: | This substance is a derivative of 2,4-D [94-75-7]. |
| Structure: | |
| Pronunciation: | too for dē mē-thīl-a-mōn-ē-am Guide to British pronunciation |
| InChIKey: | VQWMPJSLLQFUIB-UHFFFAOYSA-N |
| InChI: | InChI=1S/C8H6Cl2O3.CH5N/c9-5-1-2-7(6(10)3-5)13-4-8(11)12;1-2/h1-3H,4H2,(H,11,12);2H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names