Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | potassium (2,4-dichlorophenoxy)acetate |
IUPAC name: | potassium (2,4-dichlorophenoxy)acetate |
CAS name: | potassium (2,4-dichlorophenoxy)acetate |
CAS Reg. No.: | 14214-89-2 |
Formula: | C8H5Cl2KO3 |
Activity: | herbicides (phenoxyacetic) |
Notes: | This substance is a derivative of 2,4-D [94-75-7]. |
Structure: | |
Pronunciation: | too for dē pa-tǎs-ē-am Guide to British pronunciation |
InChIKey: | XKTWNXNNDKRPHR-UHFFFAOYSA-M |
InChI: | InChI=1S/C8H6Cl2O3.K/c9-5-1-2-7(6(10)3-5)13-4-8(11)12;/h1-3H,4H2,(H,11,12);/q;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names