Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | propyl (2,4-dichlorophenoxy)acetate |
IUPAC name: | propyl (2,4-dichlorophenoxy)acetate |
CAS name: | propyl 2-(2,4-dichlorophenoxy)acetate |
CAS Reg. No.: | 1928-61-6 |
Formula: | C11H12Cl2O3 |
Activity: | herbicides (phenoxyacetic) |
Notes: | This substance is a derivative of 2,4-D [94-75-7]. |
Structure: | |
Pronunciation: | too for dē prō-pīl Guide to British pronunciation |
InChIKey: | URELEWKDONECLX-UHFFFAOYSA-N |
InChI: | InChI=1S/C11H12Cl2O3/c1-2-5-15-11(14)7-16-10-4-3-8(12)6-9(10)13/h3-4,6H,2,5,7H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names