Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | rac-[(2R)-oxolan-2-yl]methyl (2,4-dichlorophenoxy)acetate |
IUPAC name: | (RS)-tetrahydrofurfuryl (2,4-dichlorophenoxy)acetate |
CAS name: | (tetrahydro-2-furanyl)methyl 2-(2,4-dichlorophenoxy)acetate |
CAS Reg. No.: | 15146-99-3 |
Formula: | C13H14Cl2O4 |
Activity: | herbicides (phenoxyacetic) |
Notes: | This substance is a derivative of 2,4-D [94-75-7]. |
Structure: | |
Pronunciation: | too for dē těf-ūr-īl Guide to British pronunciation |
InChIKey: | SBXXZSKNQDULKP-UHFFFAOYSA-N |
InChI: | InChI=1S/C13H14Cl2O4/c14-9-3-4-12(11(15)6-9)18-8-13(16)19-7-10-2-1-5-17-10/h3-4,6,10H,1-2,5,7-8H2 |
A data sheet from the Compendium of Pesticide Common Names