| Approval: | Parent – ISO | 
|---|---|
| IUPAC PIN: | (2,4-dichlorophenoxy)acetic acid—2,2′,2″-nitrilotri(ethan-1-ol) (1/1) | 
| IUPAC name: | (2,4-dichlorophenoxy)acetic acid - 2,2′,2″-nitrilotriethanol (1:1) or tris(2-hydroxyethyl)ammonium (2,4-dichlorophenoxy)acetate  | 
| CAS name: | 2-(2,4-dichlorophenoxy)acetic acid compound with 2,2′,2″-nitrilotris[ethanol] (1:1) | 
| CAS Reg. No.: | 2569-01-9 | 
| Formula: | C14H21Cl2NO6 | 
| Activity: | herbicides (phenoxyacetic) | 
| Notes: | This substance is a derivative of 2,4-D [94-75-7]. | 
| Structure: | |
| Pronunciation: | too for dē trǒl-a-mēn Guide to British pronunciation | 
| InChIKey: | OLHMQEQGSVBLTJ-UHFFFAOYSA-N | 
| InChI: | InChI=1S/C8H6Cl2O3.C6H15NO3/c9-5-1-2-7(6(10)3-5)13-4-8(11)12;8-4-1-7(2-5-9)3-6-10/h1-3H,4H2,(H,11,12);8-10H,1-6H2 | 
A data sheet from the Compendium of Pesticide Common Names