| Approval: | Parent – ISO |
|---|---|
| IUPAC name: | (E)-L-2-[2-(2-aminoethoxy)vinyl]glycine hydrochloride |
| CAS name: | (2S,3E)-2-amino-4-(2-aminoethoxy)-3-butenoic acid hydrochloride (1:1) |
| CAS Reg. No.: | 55720-26-8 |
| Formula: | C6H13ClN2O3 |
| Activity: | plant growth regulators (ethylene inhibitor) |
| Notes: | This substance is a derivative of aviglycine [49669-74-1]. The name “AVG hydrochloride” has been used in the literature, but it has no official approval. |
| Structure: |  |
| Pronunciation: | ǎv-ǐ-glī-sēn hī-drō-klor-īd Guide to British pronunciation |
| InChIKey: | ZDCPLYVEFATMJF-BTIOQYSDSA-N |
| InChI: | InChI=1S/C6H12N2O3.ClH/c7-2-4-11-3-1-5(8)6(9)10;/h1,3,5H,2,4,7-8H2,(H,9,10);1H/b3-1+;/t5-;/m0./s1 |