| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | rac-lithium 5-bromo-1-[((2R)-butan-2-yl]-4-methyl-6-oxo-1,6-dihydropyrimidin-2-olate |
| IUPAC name: | lithium (RS)-5-bromo-1-sec-butyl-1,6-dihydro-4-methyl-6-oxopyrimidin-2-olate |
| CAS name: | 5-bromo-6-methyl-3-(1-methylpropyl)-2,4(1H,3H)-pyrimidinedione lithium salt |
| CAS Reg. No.: | 53404-19-6 |
| Formula: | C9H12BrLiN2O2 |
| Activity: | herbicides (uracil) |
| Notes: | This substance is a derivative of bromacil [314-40-9]. |
| Structure: | |
| Pronunciation: | brō-ma-sǐl lǐth-ē-am Guide to British pronunciation |
| InChIKey: | BJLAKIGBVNZDDN-UHFFFAOYSA-M |
| InChI: | InChI=1S/C9H13BrN2O2.Li/c1-4-5(2)12-8(13)7(10)6(3)11-9(12)14;/h5H,4H2,1-3H3,(H,11,14);/q;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names