| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | methyl 3-amino-2,5-dichlorobenzoate |
| IUPAC name: | methyl 3-amino-2,5-dichlorobenzoate |
| CAS name: | methyl 3-amino-2,5-dichlorobenzoate |
| CAS Reg. No.: | 7286-84-2 |
| Formula: | C8H7Cl2NO2 |
| Activity: | herbicides (benzoic acid) |
| Notes: | This substance is a derivative of chloramben [133-90-4]. |
| Structure: | |
| Pronunciation: | klor-ǎm-běn mē-thīl Guide to British pronunciation |
| InChIKey: | DTSSCQVCVYZGSI-UHFFFAOYSA-N |
| InChI: | InChI=1S/C8H7Cl2NO2/c1-13-8(12)5-2-4(9)3-6(11)7(5)10/h2-3H,11H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names