| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | dimethyl 2,3,5,6-tetrachlorobenzene-1,4-dicarboxylate |
| IUPAC name: | dimethyl tetrachloroterephthalate |
| CAS name: | 1,4-dimethyl 2,3,5,6-tetrachloro-1,4-benzenedicarboxylate |
| CAS Reg. No.: | 1861-32-1 |
| Formula: | C10H6Cl4O4 |
| Activity: | herbicides (benzoic acid) |
| Notes: | This substance is a derivative of chlorthal [2136-79-0]. The name “DCPA” is approved by the Weed Science Society of America. The names “chlorthal” and “chlorthal-dimethyl” were both formerly approved by ISO, but “chlorthal-dimethyl” was deleted. |
| Structure: |  |
| Pronunciation: | klor-thǎl dī-mē-thīl Guide to British pronunciation |
| InChIKey: | NPOJQCVWMSKXDN-UHFFFAOYSA-N |
| InChI: | InChI=1S/C10H6Cl4O4/c1-17-9(15)3-5(11)7(13)4(10(16)18-2)8(14)6(3)12/h1-2H3 |