| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC PIN: | 3,6-dichloropyridine-2-carboxylic acid—N-methylmethanamine (1/1) |
| IUPAC name: | 3,6-dichloropyridine-2-carboxylic acid - dimethylamine (1:1) or dimethylammonium 3,6-dichloropyridine-2-carboxylate or 3,6-dichloropicolinic acid - dimethylamine (1:1) or dimethylammonium 3,6-dichloropicolinate |
| CAS name: | 3,6-dichloropyridine-2-carboxylic acid compound with N-methylmethanamine (1:1) |
| CAS Reg. No.: | 1096483-37-2 |
| Formula: | C8H10Cl2N2O2 |
| Activity: | herbicides (pyridinecarboxylic acid) |
| Notes: | This substance is a derivative of clopyralid [1702-17-6]. |
| Structure: |  |
| Pronunciation: | klō-pīr-a-lǐd dī-mē-thīl-a-mōn-ē-am Guide to British pronunciation |
| InChIKey: | CUASZCRMLPIGPY-UHFFFAOYSA-N |
| InChI: | InChI=1S/C6H3Cl2NO2.C2H7N/c7-3-1-2-4(8)9-5(3)6(10)11;1-3-2/h1-2H,(H,10,11);3H,1-2H3 |