| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | methyl 3,6-dichloropyridine-2-carboxylate |
| IUPAC name: | methyl 3,6-dichloropyridine-2-carboxylate or methyl 3,6-dichloropicolinate |
| CAS name: | methyl 3,6-dichloro-2-pyridinecarboxylate |
| CAS Reg. No.: | 1532-24-7 |
| Formula: | C7H5Cl2NO2 |
| Activity: | herbicides (pyridinecarboxylic acid) |
| Notes: | This substance is a derivative of clopyralid [1702-17-6]. |
| Structure: | |
| Pronunciation: | klō-pīr-a-lǐd mē-thīl Guide to British pronunciation |
| InChIKey: | HQTUEAOWLVWJLF-UHFFFAOYSA-N |
| InChI: | InChI=1S/C7H5Cl2NO2/c1-12-7(11)6-4(8)2-3-5(9)10-6/h2-3H,1H3 |
A data sheet from the Compendium of Pesticide Common Names