| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | rac-2-[(2R)-butan-2-yl]-4,6-dinitrophenol—2,2′-azanediyldi(ethan-1-ol) (1/1) |
| IUPAC name: | (RS)-2-sec-butyl-4,6-dinitrophenol - 2,2′-iminodiethanol (1:1) or bis(2-hydroxyethyl)ammonium (RS)-2-sec-butyl-4,6-dinitrophenoxide |
| CAS name: | 2-(1-methylpropyl)-4,6-dinitrophenol compound with 2,2′-iminobis[ethanol] (1:1) |
| CAS Reg. No.: | 53404-43-6 |
| Formula: | C14H23N3O7 |
| Activity: | herbicides (dinitrophenol) |
| Notes: | This substance is a derivative of dinoseb [88-85-7]. |
| Structure: | |
| Pronunciation: | dī-nō-sěb dī-ǒl-a-mēn Guide to British pronunciation |
| InChIKey: | LITHUQSNACPLIL-UHFFFAOYSA-N |
| InChI: | InChI=1S/C10H12N2O5.C4H11NO2/c1-3-6(2)8-4-7(11(14)15)5-9(10(8)13)12(16)17;6-3-1-5-2-4-7/h4-6,13H,3H2,1-2H3;5-7H,1-4H2 |
A data sheet from the Compendium of Pesticide Common Names