| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | rac-2-[(2R)-butan-2-yl]-4,6-dinitrophenol—2,2′,2″-nitrilotri(ethan-1-ol) (1/1) |
| IUPAC name: | (RS)-2-sec-butyl-4,6-dinitrophenol - 2,2′,2″-nitrilotriethanol or tris(2-hydroxyethyl)ammonium (RS)-2-sec-butyl-4,6-dinitrophenolate |
| CAS name: | 2-(1-methylpropyl)-4,6-dinitrophenol compound with 2,2′,2″-nitrilotris[ethanol] (1:1) |
| CAS Reg. No.: | 6420-47-9 |
| Formula: | C16H27N3O8 |
| Activity: | herbicides (dinitrophenol) |
| Notes: | This substance is a derivative of dinoseb [88-85-7]. |
| Structure: | |
| Pronunciation: | dī-nō-sěb trǒl-a-mēn Guide to British pronunciation |
| InChIKey: | YRKPPLCJMDGOOY-UHFFFAOYSA-N |
| InChI: | InChI=1S/C10H12N2O5.C6H15NO3/c1-3-6(2)8-4-7(11(14)15)5-9(10(8)13)12(16)17;8-4-1-7(2-5-9)3-6-10/h4-6,13H,3H2,1-2H3;8-10H,1-6H2 |
A data sheet from the Compendium of Pesticide Common Names