| Approval: | Parent – ISO | 
|---|---|
| IUPAC PIN: | methyl 4-amino-3,5,6-trichloropyridine-2-carboxylate | 
| IUPAC name: | methyl 4-amino-3,5,6-trichloropyridine-2-carboxylate or methyl 4-amino-3,5,6-trichloropicolinate  | 
| CAS name: | methyl 4-amino-3,5,6-trichloro-2-pyridinecarboxylate | 
| CAS Reg. No.: | 14143-55-6 | 
| Formula: | C7H5Cl3N2O2 | 
| Activity: | herbicides (pyridinecarboxylic acid) | 
| Notes: | This substance is a derivative of picloram [1918-02-1]. | 
| Structure: | |
| Pronunciation: | pǐ-klor-ǎm mē-thīl Guide to British pronunciation | 
| InChIKey: | RJQUHEYNLDNJLN-UHFFFAOYSA-N | 
| InChI: | InChI=1S/C7H5Cl3N2O2/c1-14-7(13)5-2(8)4(11)3(9)6(10)12-5/h1H3,(H2,11,12) | 
A data sheet from the Compendium of Pesticide Common Names