| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | 4-amino-3,5,6-trichloropyridine-2-carboxylic acid—2-aminoethan-1-ol (1:1) |
| IUPAC name: | 4-amino-3,5,6-trichloropyridine-2-carboxylic acid - 2-aminoethanol (1:1) or (2-hydroxyethyl)ammonium 4-amino-3,5,6-trichloropyridine-2-carboxylate or 4-amino-3,5,6-trichloropicolinic acid - 2-aminoethanol (1:1) or (2-hydroxyethyl)ammonium 4-amino-3,5,6-trichloropicolinate |
| CAS name: | 4-amino-3,5,6-trichloro-2-pyridinecarboxylic acid compound with 2-aminoethanol (1:1) |
| CAS Reg. No.: | 55871-00-6 |
| Formula: | C9H10Cl3N3O3 |
| Activity: | herbicides (pyridinecarboxylic acid) |
| Notes: | This substance is a derivative of picloram [1918-02-1]. |
| Structure: | |
| Pronunciation: | pǐ-klor-ǎm ǒl-a-mēn Guide to British pronunciation |
| InChIKey: | IFYBRLPVVJLYIF-UHFFFAOYSA-N |
| InChI: | InChI=1S/C6H3Cl3N2O2.C2H7NO/c7-1-3(10)2(8)5(9)11-4(1)6(12)13;3-1-2-4/h(H2,10,11)(H,12,13);4H,1-3H2 |
A data sheet from the Compendium of Pesticide Common Names