| Approval: | ISO preferred name |
|---|---|
| IUPAC PIN: | sodium [1,1′-biphenyl]-2-olate |
| IUPAC name: | sodium biphenyl-2-olate |
| CAS name: | [1,1′-biphenyl]-2-ol sodium salt |
| CAS Reg. No.: | 132-27-4 |
| Formula: | C12H9NaO |
| Activity: | fungicides (phenol) |
| Notes: | This substance is a derivative of 2-phenylphenol [90-43-7].An alternative name is “sodium orthophenylphenoxide”. |
| Structure: | |
| Pronunciation: | sō-dē-am or-thō-fē-nīl-fěn-ǒk-sīd Guide to British pronunciation |
| InChIKey: | KSQXVLVXUFHGJQ-UHFFFAOYSA-M |
| InChI: | InChI=1S/C12H10O.Na/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;/h1-9,13H;/q;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names