Approval: | ISO |
---|---|
IUPAC PIN: | S-[(2Ξ)-2,3-dichloroprop-2-en-1-yl] di(propan-2-yl)carbamothioate |
IUPAC name: | S-(EZ)-2,3-dichloroallyl diisopropylcarbamothioate 1979 Rules: S-(EZ)-2,3-dichloroallyl diisopropyl(thiocarbamate) |
CAS name: | S-(2,3-dichloro-2-propen-1-yl) N,N-bis(1-methylethyl)carbamothioate |
CAS Reg. No.: | 2303-16-4 |
Formula: | C10H17Cl2NOS |
Activity: | herbicides (thiocarbamate) |
Notes: | The name “diallate” is approved by the Weed Science Society of America. |
Structure: | |
Pronunciation: | dī-ǎl-āt Guide to British pronunciation |
InChIKey: | SPANOECCGNXGNR-UHFFFAOYSA-N |
InChI: | InChI=1S/C10H17Cl2NOS/c1-7(2)13(8(3)4)10(14)15-6-9(12)5-11/h5,7-8H,6H2,1-4H3 |
A data sheet from the Compendium of Pesticide Common Names