Status: | ISO 765 (published) |
---|---|
IUPAC PIN: | dibutyl benzene-1,2-dicarboxylate |
IUPAC name: | dibutyl phthalate |
CAS name: | 1,2-dibutyl 1,2-benzenedicarboxylate |
CAS Reg. No.: | 84-74-2 |
Formula: | C16H22O4 |
Activity: | insect repellents |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
Structure: | |
Pronunciation: | dī-bū-tīl fthǎl-āt Guide to British pronunciation |
InChIKey: | DOIRQSBPFJWKBE-UHFFFAOYSA-N |
InChI: | InChI=1S/C16H22O4/c1-3-5-11-19-15(17)13-9-7-8-10-14(13)16(18)20-12-6-4-2/h7-10H,3-6,11-12H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names