| Approval: | ISO preferred name |
|---|---|
| IUPAC PIN: | dibutyl butanedioate |
| IUPAC name: | dibutyl succinate |
| CAS name: | 1,4-dibutyl butanedioate |
| CAS Reg. No.: | 141-03-7 |
| Formula: | C12H22O4 |
| Activity: | insect repellents |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: | |
| Pronunciation: | dī-bū-tīl sǔk-sǐn-āt Guide to British pronunciation |
| InChIKey: | YUXIBTJKHLUKBD-UHFFFAOYSA-N |
| InChI: | InChI=1S/C12H22O4/c1-3-5-9-15-11(13)7-8-12(14)16-10-6-4-2/h3-10H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names