| Approval: | ESA |
|---|---|
| IUPAC PIN: | O-(2-chloro-4-nitrophenyl) O,O-dimethyl phosphorothioate |
| IUPAC name: | O-(2-chloro-4-nitrophenyl) O,O-dimethyl phosphorothioate |
| CAS name: | O-(2-chloro-4-nitrophenyl) O,O-dimethyl phosphorothioate |
| CAS Reg. No.: | 2463-84-5 |
| Formula: | C8H9ClNO5PS |
| Activity: | insecticides (phenyl organothiophosphate) |
| Notes: | There is no ISO common name for this substance; the name “dicapthon” is approved by the Entomological Society of America, the American National Standards Institute and is also approved in China (异氯磷). |
| Structure: | |
| Pronunciation: | dī-kǎp-thǒn Guide to British pronunciation |
| InChIKey: | OTKXWJHPGBRXCR-UHFFFAOYSA-N |
| InChI: | InChI=1S/C8H9ClNO5PS/c1-13-16(17,14-2)15-8-4-3-6(10(11)12)5-7(8)9/h3-5H,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names