Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | rac-(2R)-2-[4-(2,4-dichlorophenoxy)phenoxy]propanoic acid |
IUPAC name: | (2RS)-2-[4-(2,4-dichlorophenoxy)phenoxy]propanoic acid 1979 Rules: (RS)-2-[4-(2,4-dichlorophenoxy)phenoxy]propionic acid |
CAS name: | 2-[4-(2,4-dichlorophenoxy)phenoxy]propanoic acid |
CAS Reg. No.: | 40843-25-2 |
Formula: | C15H12Cl2O4 |
Activity: | herbicides (aryloxyphenoxypropionic) |
Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example diclofop-methyl [51338-27-3]. |
Structure: | |
Pronunciation: | dī-clō-fǒp Guide to British pronunciation |
InChIKey: | OOLBCHYXZDXLDS-UHFFFAOYSA-N |
InChI: | InChI=1S/C15H12Cl2O4/c1-9(15(18)19)20-11-3-5-12(6-4-11)21-14-7-2-10(16)8-13(14)17/h2-9H,1H3,(H,18,19) |
A data sheet from the Compendium of Pesticide Common Names