| Approval: | WHO INN |
|---|---|
| IUPAC PIN: | 3,3′-methylenebis(4-hydroxy-2H-1-benzopyran-2-one) |
| IUPAC name: | 3,3′-methylenebis(4-hydroxy-2H-chromen-2-one) 1979 Rules: 3,3′-methylenebis(4-hydroxycoumarin) |
| CAS name: | 3,3′-methylenebis[4-hydroxy-2H-1-benzopyran-2-one] |
| CAS Reg. No.: | 66-76-2 |
| Formula: | C19H12O6 |
| Activity: | rodenticides (coumarin) |
| Notes: | There is no ISO common name for this substance; the name “dicoumarol” is approved by the World Health Organization. The name “dicumarol” is approved in the United States of America. The name “melitoxin” (敌鼠灵) is approved in China, even though Melitoxin is (or was) a registered trade mark in many countries. |
| Structure: | |
| Pronunciation: | dī-koom-a-rǒl Guide to British pronunciation |
| InChIKey: | DOBMPNYZJYQDGZ-UHFFFAOYSA-N |
| InChI: | InChI=1S/C19H12O6/c20-16-10-5-1-3-7-14(10)24-18(22)12(16)9-13-17(21)11-6-2-4-8-15(11)25-19(13)23/h1-8,20-21H,9H2 |
A data sheet from the Compendium of Pesticide Common Names