Approval: | ISO |
---|---|
IUPAC PIN: | 1,2-dimethyl-3,5-diphenyl-1H-pyrazol-2-ium |
IUPAC name: | 1,2-dimethyl-3,5-diphenyl-1H-pyrazolium |
CAS name: | 1,2-dimethyl-3,5-diphenyl-1H-pyrazolium |
CAS Reg. No.: | 49866-87-7 |
Formula: | C17H17N2 |
Activity: | herbicides (quaternary ammonium) |
Notes: | Derivatives include difenzoquat metilsulfate [43222-48-6]. The name “野燕枯” is approved in China for difenzoquat and for difenzoquat metilsulfate. |
Structure: | |
Pronunciation: | dī-fěn-zō-kwǒt Guide to British pronunciation |
InChIKey: | LBGPXIPGGRQBJW-UHFFFAOYSA-N |
InChI: | InChI=1S/C17H17N2/c1-18-16(14-9-5-3-6-10-14)13-17(19(18)2)15-11-7-4-8-12-15/h3-13H,1-2H3/q+1 |
A data sheet from the Compendium of Pesticide Common Names