Approval: | ISO |
---|---|
IUPAC PIN: | 3-(2-chlorophenyl)-6-(2,6-difluorophenyl)-1,2,4,5-tetrazine |
IUPAC name: | 3-(2-chlorophenyl)-6-(2,6-difluorophenyl)-1,2,4,5-tetrazine |
CAS name: | 3-(2-chlorophenyl)-6-(2,6-difluorophenyl)-1,2,4,5-tetrazine |
CAS Reg. No.: | 162320-67-4 |
Formula: | C14H7ClF2N4 |
Activity: | acaricides (tetrazine) |
Notes: | The names “flufenzine” and “flutenzine” have been used in the literature, but they have no official approval. |
Structure: | |
Pronunciation: | dī-flō-vǐd-a-zǐn Guide to British pronunciation |
InChIKey: | SWBHWUYHHJCADA-UHFFFAOYSA-N |
InChI: | InChI=1S/C14H7ClF2N4/c15-9-5-2-1-4-8(9)13-18-20-14(21-19-13)12-10(16)6-3-7-11(12)17/h1-7H |
A data sheet from the Compendium of Pesticide Common Names