| Approval: | ISO |
|---|---|
| IUPAC PIN: | 3-(2-chlorophenyl)-6-(2,6-difluorophenyl)-1,2,4,5-tetrazine |
| IUPAC name: | 3-(2-chlorophenyl)-6-(2,6-difluorophenyl)-1,2,4,5-tetrazine |
| CAS name: | 3-(2-chlorophenyl)-6-(2,6-difluorophenyl)-1,2,4,5-tetrazine |
| CAS Reg. No.: | 162320-67-4 |
| Formula: | C14H7ClF2N4 |
| Activity: | acaricides (tetrazine) |
| Notes: | The name “flutenzine” has been used in the literature, but it has no official approval. The name “flufenzine” (флуфензин) is accepted in Russia. |
| Structure: | |
| Pronunciation: | dī-flō-vǐd-a-zǐn Guide to British pronunciation |
| InChIKey: | SWBHWUYHHJCADA-UHFFFAOYSA-N |
| InChI: | InChI=1S/C14H7ClF2N4/c15-9-5-2-1-4-8(9)13-18-20-14(21-19-13)12-10(16)6-3-7-11(12)17/h1-7H |
A data sheet from the Compendium of Pesticide Common Names