Approval: | ISO common name not required |
---|---|
IUPAC PIN: | dimethyl benzene-1,2-dicarboxylate |
IUPAC name: | dimethyl phthalate |
CAS name: | 1,2-dimethyl 1,2-benzenedicarboxylate |
CAS Reg. No.: | 131-11-3 |
Formula: | C10H10O4 |
Activity: | insect repellents |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
Structure: | |
Pronunciation: | dī-mē-thīl fthǎl-āt Guide to British pronunciation |
InChIKey: | NIQCNGHVCWTJSM-UHFFFAOYSA-N |
InChI: | InChI=1S/C10H10O4/c1-13-9(11)7-5-3-4-6-8(7)10(12)14-2/h3-6H,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names