Approval: | ISO |
---|---|
IUPAC PIN: | 1-(dimethylcarbamoyl)-5-methyl-1H-pyrazol-3-yl dimethylcarbamate |
IUPAC name: | 1-(dimethylcarbamoyl)-5-methyl-1H-pyrazol-3-yl dimethylcarbamate |
CAS name: | 1-[(dimethylamino)carbonyl]-5-methyl-1H-pyrazol-3-yl N,N-dimethylcarbamate |
CAS Reg. No.: | 644-64-4 |
Formula: | C10H16N4O3 |
Activity: | insecticides (dimethylcarbamate) |
Notes: | The name “dimetilan” was formerly approved by the British Standards Institution. |
Structure: | |
Pronunciation: | di-mět-ǐ-lǎn Guide to British pronunciation |
InChIKey: | RDBIYWSVMRVKSG-UHFFFAOYSA-N |
InChI: | InChI=1S/C10H16N4O3/c1-7-6-8(17-10(16)13(4)5)11-14(7)9(15)12(2)3/h6H,1-5H3 |
A data sheet from the Compendium of Pesticide Common Names