Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | O,O-dimethyl 2-(dithioperoxy)-1,3-dithiodicarbonate |
IUPAC name: | O,O-dimethyl dithiobis(thioformate) |
CAS name: | thioperoxydicarbonic acid ([(HO)C(S)]2S2) dimethyl ester |
CAS Reg. No.: | 1468-37-7 |
Formula: | C4H6O2S4 |
Activity: | herbicides (thiocarbonate) |
Notes: | The analogous diethyl ester has the WSSA common name EXD [502-55-6]. |
Structure: | |
Pronunciation: | dī-měks-a-nō Guide to British pronunciation |
InChIKey: | FVCPXLWAKNJIKK-UHFFFAOYSA-N |
InChI: | InChI=1S/C4H6O2S4/c1-5-3(7)9-10-4(8)6-2/h1-2H3 |
A data sheet from the Compendium of Pesticide Common Names