Approval: | ISO |
---|---|
IUPAC PIN: | mixture of 50%–80% rac-(2R,4S)-2-ethyl-4-[(4-phenoxyphenoxy)methyl]-1,3-dioxolane and 50%–20% rac-(2R,4R)-2-ethyl-4-[(4-phenoxyphenoxy)methyl]-1,3-dioxolane |
IUPAC name: | mixture of 50%–80% (2RS,4SR)-4-[(2-ethyl-1,3-dioxolan-4-yl)methoxy]phenyl phenyl ether and 50%–20% (2RS,4RS)-4-[(2-ethyl-1,3-dioxolan-4-yl)methoxy]phenyl phenyl ether |
CAS name: | 2-ethyl-4-[(4-phenoxyphenoxy)methyl]-1,3-dioxolane |
CAS Reg. No.: | 63837-33-2 |
Formula: | C18H20O4 |
Activity: | insecticides (juvenile hormone mimic) |
Notes: | |
Structure: | |
Pronunciation: | dī-ō-fēn-ō-lǎn Guide to British pronunciation |
InChIKey: | ZDOOQPFIGYHZFV-UHFFFAOYSA-N |
InChI: | InChI=1S/C18H20O4/c1-2-18-20-13-17(22-18)12-19-14-8-10-16(11-9-14)21-15-6-4-3-5-7-15/h3-11,17-18H,2,12-13H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names