Approval: | ISO common name not required |
---|---|
IUPAC PIN: | N-phenylaniline |
IUPAC name: | diphenylamine |
CAS name: | N-phenylbenzenamine |
CAS Reg. No.: | 122-39-4 |
Formula: | C12H11N |
Activity: | fungicides (aromatic) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
Structure: | |
Pronunciation: | dī-fē-nīl-a-mēn Guide to British pronunciation |
InChIKey: | DMBHHRLKUKUOEG-UHFFFAOYSA-N |
InChI: | InChI=1S/C12H11N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10,13H |
A data sheet from the Compendium of Pesticide Common Names