diphenylamine

Chinese: 二苯胺French: diphénylamine (n.f.)Russian: дифениламин


Approval: ISO common name not required
IUPAC PIN: N-phenylaniline
IUPAC name: diphenylamine
CAS name: N-phenylbenzenamine
CAS Reg. No.: 122-39-4
Formula: C12H11N
Activity: fungicides (aromatic)
Notes: This substance is considered by the International Organization for Standardization not to require a common name.
Structure: Structural formula of diphenylamine
Pronunciation: dī-fē-nīl-a-mēn  Guide to British pronunciation
InChIKey: DMBHHRLKUKUOEG-UHFFFAOYSA-N
InChI: InChI=1S/C12H11N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10,13H

A data sheet from the Compendium of Pesticide Common Names