| Approval: | China |
|---|---|
| IUPAC PIN: | 4-methyl-2,6-dinitro-N,N-dipropylaniline |
| IUPAC name: | 4-methyl-2,6-dinitro-N,N-dipropylaniline 1979 Rules: 2,6-dinitro-N,N-dipropyl-p-toluidine |
| CAS name: | 4-methyl-2,6-dinitro-N,N-dipropylbenzenamine |
| CAS Reg. No.: | 1918-08-7 |
| Formula: | C13H19N3O4 |
| Activity: | herbicides (dinitroaniline) |
| Notes: | There is no ISO common name for this substance; the name “dipropalin” (地乐灵) is approved in China. |
| Structure: | |
| Pronunciation: | dī-prōp-a-lǐn Guide to British pronunciation |
| InChIKey: | UDVZOMAEGATTSE-UHFFFAOYSA-N |
| InChI: | InChI=1S/C13H19N3O4/c1-4-6-14(7-5-2)13-11(15(17)18)8-10(3)9-12(13)16(19)20/h8-9H,4-7H2,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names