Approval: | ISO |
---|---|
IUPAC PIN: | 2-methyl-4,6-dinitrophenol |
IUPAC name: | 2-methyl-4,6-dinitrophenol 1979 Rules: 4,6-dinitro-o-cresol |
CAS name: | 2-methyl-4,6-dinitrophenol |
CAS Reg. No.: | 534-52-1 |
Formula: | C7H6N2O5 |
Activity: | acaricides (dinitrophenol) fungicides (dinitrophenol) herbicides (dinitrophenol) insecticides (dinitrophenol) |
Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example DNOC-ammonium [2980-64-5], DNOC-potassium [5787-96-2], DNOC-sodium [2312-76-7]. |
Structure: | |
Pronunciation: | dē ěn ō sē Guide to British pronunciation |
InChIKey: | ZXVONLUNISGICL-UHFFFAOYSA-N |
InChI: | InChI=1S/C7H6N2O5/c1-4-2-5(8(11)12)3-6(7(4)10)9(13)14/h2-3,10H,1H3 |
A data sheet from the Compendium of Pesticide Common Names