Approval: | ISO |
---|---|
IUPAC PIN: | (2Ξ,6Ξ)-4-cyclododecyl-2,6-dimethylmorpholine |
IUPAC name: | 4-cyclododecyl-2,6-dimethylmorpholine |
CAS name: | 4-cyclododecyl-2,6-dimethylmorpholine |
CAS Reg. No.: | 1593-77-7 |
Formula: | C18H35NO |
Activity: | fungicides (morpholine) |
Notes: | Derivatives include dodemorph acetate [31717-87-0], dodemorph benzoate [59145-63-0]. The names “dodemorph” and “dodemorph benzoate” were both formerly approved by ISO, but “dodemorph benzoate” was deleted. |
Structure: | |
Pronunciation: | dō-dē-morf Guide to British pronunciation |
InChIKey: | JMXKCYUTURMERF-UHFFFAOYSA-N |
InChI: | InChI=1S/C18H35NO/c1-16-14-19(15-17(2)20-16)18-12-10-8-6-4-3-5-7-9-11-13-18/h16-18H,3-15H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names