| Approval: | ISO |
|---|---|
| IUPAC PIN: | N-dodecylguanidinium acetate |
| IUPAC name: | 1-dodecylguanidinium acetate |
| CAS name: | dodecylguanidine monoacetate |
| CAS Reg. No.: | 2439-10-3 |
| Formula: | C15H33N3O2 |
| Activity: | fungicides (guanidine) |
| Notes: | * The name “doguadine” (n.f.) is used in France, but the ISO common name “dodine” (n.f.) also appears to be used. The name “cytrex” (цитрекс) was used in the former USSR. |
| Structure: |  |
| Pronunciation: | dō-dēn Guide to British pronunciation |
| InChIKey: | YIKWKLYQRFRGPM-UHFFFAOYSA-N |
| InChI: | InChI=1S/C13H29N3.C2H4O2/c1-2-3-4-5-6-7-8-9-10-11-12-16-13(14)15;1-2(3)4/h2-12H2,1H3,(H4,14,15,16);1H3,(H,3,4) |