| Approval: | JMAFF | 
|---|---|
| IUPAC PIN: | 4-(ethylsulfanyl)phenyl methylcarbamate | 
| IUPAC name: | 4-(ethylthio)phenyl methylcarbamate | 
| CAS name: | 4-(ethylthio)phenyl N-methylcarbamate | 
| CAS Reg. No.: | 18809-57-9 | 
| Formula: | C10H13NO2S | 
| Activity: | insecticides (phenyl carbamate) | 
| Notes: | There is no ISO common name for this substance; the name “EMPC” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries, and is also approved in China (多杀威). | 
| Structure: | |
| Pronunciation: | ē ěm pē sē Guide to British pronunciation | 
| InChIKey: | OZJCQBUSEOVJOW-UHFFFAOYSA-N | 
| InChI: | InChI=1S/C10H13NO2S/c1-3-14-9-6-4-8(5-7-9)13-10(12)11-2/h4-7H,3H2,1-2H3,(H,11,12) | 
A data sheet from the Compendium of Pesticide Common Names