Approval: | JMAFF |
---|---|
IUPAC PIN: | 4-(ethylsulfanyl)phenyl methylcarbamate |
IUPAC name: | 4-(ethylthio)phenyl methylcarbamate |
CAS name: | 4-(ethylthio)phenyl N-methylcarbamate |
CAS Reg. No.: | 18809-57-9 |
Formula: | C10H13NO2S |
Activity: | insecticides (phenyl carbamate) |
Notes: | There is no ISO common name for this substance; the name “EMPC” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries, and is also approved in China (多杀威). |
Structure: | |
Pronunciation: | ē ěm pē sē Guide to British pronunciation |
InChIKey: | OZJCQBUSEOVJOW-UHFFFAOYSA-N |
InChI: | InChI=1S/C10H13NO2S/c1-3-14-9-6-4-8(5-7-9)13-10(12)11-2/h4-7H,3H2,1-2H3,(H,11,12) |
A data sheet from the Compendium of Pesticide Common Names