| Approval: | China |
|---|---|
| IUPAC PIN: | 2-chloro-N-(2-ethylphenyl)-N-propan-2-ylacetamide |
| IUPAC name: | 2-chloro-2′-ethyl-N-isopropylacetanilide |
| CAS name: | 2-chloro-N-(2-ethylphenyl)-N-(1-methylethyl)acetamide |
| CAS Reg. No.: | |
| Formula: | C13H18ClNO |
| Activity: | herbicides (chloroacetamide) |
| Notes: | There is no ISO common name for this substance; the name “ethaprochlor” (杀草胺) is approved in China. |
| Structure: | |
| Pronunciation: | ě-thǎp-rō-klor Guide to British pronunciation |
| InChIKey: | CIGFIQQHUGBWEL-UHFFFAOYSA-N |
| InChI: | InChI=1S/C13H18ClNO/c1-4-11-7-5-6-8-12(11)15(10(2)3)13(16)9-14/h5-8,10H,4,9H2,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names