| Approval: | JMAFF |
|---|---|
| IUPAC PIN: | ethyl (5-chloro-1H-indazol-3-yl)acetate |
| IUPAC name: | ethyl 5-chloro-3(1H)-indazolylacetate |
| CAS name: | ethyl 5-chloro-1H-indazole-3-acetate |
| CAS Reg. No.: | 27512-72-7 |
| Formula: | C11H11ClN2O2 |
| Activity: | plant growth regulators (auxin) |
| Notes: | There is no ISO common name for this substance; the name “ethychlozate” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries, and is also approved in China (吲熟酯). |
| Structure: | |
| Pronunciation: | ěth-ī-klō-zāt Guide to British pronunciation |
| InChIKey: | GLPZEHFBLBYFHN-UHFFFAOYSA-N |
| InChI: | InChI=1S/C11H11ClN2O2/c1-2-16-11(15)6-10-8-5-7(12)3-4-9(8)13-14-10/h3-5H,2,6H2,1H3,(H,13,14) |
A data sheet from the Compendium of Pesticide Common Names