| Approval: |
ISO common name not required |
| IUPAC name: |
(RS)-3-(ethylmercurythio)propane-1,2-diol |
| CAS name: |
ethyl[3-(mercapto-κS)-1,2-propanediolato]mercury |
| CAS Reg. No.: |
2597-92-4 |
| Formula: |
C5H12HgO2S |
| Activity: |
fungicides (mercury compound) |
| Notes: |
This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: |
 |
| Pronunciation: |
ē-thīl-mer-kūr-ē too thrē dī-hī-drǒks-ē-prō-pīl mer-kǎp-tīd Guide to British pronunciation |
| InChIKey: |
KVJOLVBEUYUHLD-UHFFFAOYSA-M |
| InChI: |
InChI=1S/C3H8O2S.C2H5.Hg/c4-1-3(5)2-6;1-2;/h3-6H,1-2H2;1H2,2H3;/q;;+1/p-1 |