Approval: | ISO common name not required |
---|---|
IUPAC name: | ethylmercuric acetate (deprecated) 2005 Rules: (acetato-κO)(ethyl)mercury |
CAS name: | (acetato-κO)ethylmercury |
CAS Reg. No.: | 109-62-6 |
Formula: | C4H8HgO2 |
Activity: | fungicides (mercury compound) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
Structure: | |
Pronunciation: | ē-thīl-mer-kūr-ē ǎs-ǐ-tāt Guide to British pronunciation |
InChIKey: | UVCFFGYNJOPUSF-UHFFFAOYSA-M |
InChI: | InChI=1S/C2H4O2.C2H5.Hg/c1-2(3)4;1-2;/h1H3,(H,3,4);1H2,2H3;/q;;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names