| Approval: | ISO preferred name |
|---|---|
| IUPAC name: | ethylmercuric acetate (deprecated) 2005 Rules: (acetato-κO)(ethyl)mercury |
| CAS name: | (acetato-κO)ethylmercury |
| CAS Reg. No.: | 109-62-6 |
| Formula: | C4H8HgO2 |
| Activity: | fungicides (mercury compound) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: | |
| Pronunciation: | ē-thīl-mer-kūr-ē ǎs-ǐ-tāt Guide to British pronunciation |
| InChIKey: | UVCFFGYNJOPUSF-UHFFFAOYSA-M |
| InChI: | InChI=1S/C2H4O2.C2H5.Hg/c1-2(3)4;1-2;/h1H3,(H,3,4);1H2,2H3;/q;;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names