| Approval: | ISO | 
|---|---|
| IUPAC PIN: | rac-(2R)-2-[5-(2,4-dichlorophenoxy)-2-nitrophenoxy]-N-ethylpropanamide | 
| IUPAC name: | (2RS)-2-[5-(2,4-dichlorophenoxy)-2-nitrophenoxy]-N-ethylpropanamide 1979 Rules: (RS)-2-[5-(2,4-dichlorophenoxy)-2-nitrophenoxy]-N-ethylpropionamide  | 
| CAS name: | 2-[5-(2,4-dichlorophenoxy)-2-nitrophenoxy]-N-ethylpropanamide | 
| CAS Reg. No.: | 76120-22-4 | 
| Formula: | C17H16Cl2N2O5 | 
| Activity: | herbicides (diphenyl ether) | 
| Notes: | The CAS Registry Number 76120-02-0 has often been incorrectly applied to etnipromid. | 
| Structure: | |
| Pronunciation: | ět-nī-prō-mǐd Guide to British pronunciation | 
| InChIKey: | YDEFRHHEMOGTCU-UHFFFAOYSA-N | 
| InChI: | InChI=1S/C17H16Cl2N2O5/c1-3-20-17(22)10(2)25-16-9-12(5-6-14(16)21(23)24)26-15-7-4-11(18)8-13(15)19/h4-10H,3H2,1-2H3,(H,20,22) | 
A data sheet from the Compendium of Pesticide Common Names