| Approval: | ISO | 
|---|---|
| IUPAC PIN: | 3,5-diethylphenyl methylcarbamate | 
| IUPAC name: | 3,5-diethylphenyl methylcarbamate | 
| CAS name: | 3,5-diethylphenyl N-methylcarbamate | 
| CAS Reg. No.: | 30087-47-9 | 
| Formula: | C12H17NO2 | 
| Activity: | insecticides (phenyl carbamate) | 
| Notes: | * The name “fénétacarbe” (n.m.) is also used in francophone countries. | 
| Structure: | |
| Pronunciation: | fěn-ěth-a-karb Guide to British pronunciation | 
| InChIKey: | HUNDISMVCBSIKO-UHFFFAOYSA-N | 
| InChI: | InChI=1S/C12H17NO2/c1-4-9-6-10(5-2)8-11(7-9)15-12(14)13-3/h6-8H,4-5H2,1-3H3,(H,13,14) | 
A data sheet from the Compendium of Pesticide Common Names