| Approval: | ISO |
|---|---|
| IUPAC PIN: | rac-(2R)-2-(2,4,5-trichlorophenoxy)propanoic acid |
| IUPAC name: | (2RS)-2-(2,4,5-trichlorophenoxy)propanoic acid 1979 Rules: (RS)-2-(2,4,5-trichlorophenoxy)propionic acid |
| CAS name: | 2-(2,4,5-trichlorophenoxy)propanoic acid |
| CAS Reg. No.: | 93-72-1 |
| Formula: | C9H7Cl3O3 |
| Activity: | herbicides (phenoxypropionic) plant growth regulators (auxin) |
| Notes: | Derivatives include fenoprop-butometyl [2317-24-0], fenoprop-butotyl [19398-13-1], fenoprop-butyl [13557-98-7], fenoprop-isoctyl, fenoprop-methyl [4841-20-7], fenoprop-potassium [2818-16-8], fenoprop-terboxyl [25537-26-2]. The name “silvex” is used in the USA. The name “2,4,5-TP” is also used in France, and was used in the former USSR (2,4,5-ТП). |
| Structure: |  |
| Pronunciation: | fěn-ō-prǒp Guide to British pronunciation |
| InChIKey: | ZLSWBLPERHFHIS-UHFFFAOYSA-N |
| InChI: | InChI=1S/C9H7Cl3O3/c1-4(9(13)14)15-8-3-6(11)5(10)2-7(8)12/h2-4H,1H3,(H,13,14) |