| Approval: | ISO |
|---|---|
| IUPAC name: | N-benzoyl-N-(3-chloro-4-fluorophenyl)-DL-alanine |
| CAS name: | N-benzoyl-N-(3-chloro-4-fluorophenyl)-DL-alanine |
| CAS Reg. No.: | 58667-63-3 |
| Formula: | C16H13ClFNO3 |
| Activity: | herbicides (arylaminopropionic acid) |
| Notes: | Derivatives include flamprop-isopropyl [52756-22-6], flamprop-methyl [52756-25-9]. The Chinese name “麦草伏” has also been used in the literature, but it has no official approval. The (−)-enantiomer of this substance has the ISO common name flamprop-M [90134-59-1]. |
| Structure: |  |
| Pronunciation: | flǎm-prǒp Guide to British pronunciation |
| InChIKey: | YQVMVCCFZCMYQB-UHFFFAOYSA-N |
| InChI: | InChI=1S/C16H13ClFNO3/c1-10(16(21)22)19(12-7-8-14(18)13(17)9-12)15(20)11-5-3-2-4-6-11/h2-10H,1H3,(H,21,22) |